C23H17NO5S — CID 154041550
methyl 3-[5-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-2-pyridinyl]prop-2-enoate (PubChem CID 154041550) has the molecular formula C23H17NO5S and a molecular weight of 419.46 g/mol. Its IUPAC name is methyl 3-[5-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-2-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-[5-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 154041550 |
| Molecular Formula | C23H17NO5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | methyl 3-[5-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-2-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(Oc2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cn1 |
| InChI | InChI=1S/C23H17NO5S/c1-28-21(27)11-5-15-4-9-18(13-24-15)29-22-19-10-8-17(26)12-20(19)30-23(22)14-2-6-16(25)7-3-14/h2-13,25-26H,1H3 |
| InChIKey | XTIRKOCQQCPFDZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|