C24H18O5S — CID 123281381
3-[4-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-3-methylphenyl]prop-2-enoic acid (PubChem CID 123281381) has the molecular formula C24H18O5S and a molecular weight of 418.47 g/mol. Its IUPAC name is 3-[4-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-3-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123281381 |
| Molecular Formula | C24H18O5S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 3-[4-[[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]-3-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1Oc1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C24H18O5S/c1-14-12-15(3-11-22(27)28)2-10-20(14)29-23-19-9-8-18(26)13-21(19)30-24(23)16-4-6-17(25)7-5-16/h2-13,25-26H,1H3,(H,27,28) |
| InChIKey | OPODJWBURLUCON-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|