C27H21FO4S — CID 134288096
(E)-3-[4-[[2-[2-(1-fluoro-2-methylprop-2-enyl)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 134288096) has the molecular formula C27H21FO4S and a molecular weight of 460.53 g/mol. Its IUPAC name is (E)-3-[4-[[2-[2-(1-fluoro-2-methylprop-2-enyl)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[2-(1-fluoro-2-methylprop-2-enyl)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134288096 |
| Molecular Formula | C27H21FO4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (E)-3-[4-[[2-[2-(1-fluoro-2-methylprop-2-enyl)phenyl]-6-hydroxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | C=C(C)C(F)c1ccccc1-c1sc2cc(O)ccc2c1Oc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C27H21FO4S/c1-16(2)25(28)20-5-3-4-6-21(20)27-26(22-13-10-18(29)15-23(22)33-27)32-19-11-7-17(8-12-19)9-14-24(30)31/h3-15,25,29H,1H2,2H3,(H,30,31)/b14-9+ |
| InChIKey | JFILXMSVCULVHO-NTEUORMPSA-N |
| XLogP | 7.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|