C26H24O4S — CID 90372211
3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]propanoic acid (PubChem CID 90372211) has the molecular formula C26H24O4S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 90372211 |
| Molecular Formula | C26H24O4S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-[4-[[6-hydroxy-2-(2-propan-2-ylphenyl)-1-benzothiophen-3-yl]oxy]phenyl]propanoic acid |
| SMILES | CC(C)c1ccccc1-c1sc2cc(O)ccc2c1Oc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C26H24O4S/c1-16(2)20-5-3-4-6-21(20)26-25(22-13-10-18(27)15-23(22)31-26)30-19-11-7-17(8-12-19)9-14-24(28)29/h3-8,10-13,15-16,27H,9,14H2,1-2H3,(H,28,29) |
| InChIKey | MKRCBSNFPAOKKD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |