C24H15F3O4S — CID 78322700
(E)-3-[4-[[6-hydroxy-2-[4-(trifluoromethyl)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 78322700) has the molecular formula C24H15F3O4S and a molecular weight of 456.44 g/mol. Its IUPAC name is (E)-3-[4-[[6-hydroxy-2-[4-(trifluoromethyl)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[6-hydroxy-2-[4-(trifluoromethyl)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 78322700 |
| Molecular Formula | C24H15F3O4S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (E)-3-[4-[[6-hydroxy-2-[4-(trifluoromethyl)phenyl]-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Oc2c(-c3ccc(C(F)(F)F)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C24H15F3O4S/c25-24(26,27)16-6-4-15(5-7-16)23-22(19-11-8-17(28)13-20(19)32-23)31-18-9-1-14(2-10-18)3-12-21(29)30/h1-13,28H,(H,29,30)/b12-3+ |
| InChIKey | VLWKJMJGMQBKLS-KGVSQERTSA-N |
| XLogP | 7.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|