About 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid
3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 123429688) has the molecular formula C23H14F2O5S
and a molecular weight of 440.42 g/mol. Its IUPAC name is 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| PubChem CID | 123429688 |
| Molecular Formula | C23H14F2O5S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(Oc2c(-c3ccc(O)cc3)sc3c(F)c(O)c(F)cc23)cc1 |
| InChI | InChI=1S/C23H14F2O5S/c24-17-11-16-21(30-15-8-1-12(2-9-15)3-10-18(27)28)22(13-4-6-14(26)7-5-13)31-23(16)19(25)20(17)29/h1-11,26,29H,(H,27,28) |
| InChIKey | IKUJXLNDVKDBSY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid?
The IUPAC name of 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (CID 123429688) is 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
What is the SMILES notation for 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid?
The canonical SMILES for 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid is O=C(O)C=Cc1ccc(Oc2c(-c3ccc(O)cc3)sc3c(F)c(O)c(F)cc23)cc1.
What is the InChIKey of 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid?
The InChIKey is IKUJXLNDVKDBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F2O5S/c24-17-11-16-21(30-15-8-1-12(2-9-15)3-10-18(27)28)22(13-4-6-14(26)7-5-13)31-23(16)19(25)20(17)29/h1-11,26,29H,(H,27,28).
What are the key properties of 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid?
3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid has a molecular weight of 440.42 g/mol, XLogP of 6.15, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[5,7-difluoro-6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid is sourced from PubChem (CID 123429688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).