C28H24O5S — CID 129221104
[(E)-2-[4-[[6-methoxy-2-(2,4,6-trimethylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate (PubChem CID 129221104) has the molecular formula C28H24O5S and a molecular weight of 472.56 g/mol. Its IUPAC name is [(E)-2-[4-[[6-methoxy-2-(2,4,6-trimethylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate.
| Compound Name | [(E)-2-[4-[[6-methoxy-2-(2,4,6-trimethylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate |
|---|---|
| PubChem CID | 129221104 |
| Molecular Formula | C28H24O5S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [(E)-2-[4-[[6-methoxy-2-(2,4,6-trimethylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate |
| SMILES | COc1ccc2c(Oc3ccc(/C=C/OC=O)cc3)c(C(=O)c3c(C)cc(C)cc3C)sc2c1 |
| InChI | InChI=1S/C28H24O5S/c1-17-13-18(2)25(19(3)14-17)26(30)28-27(23-10-9-22(31-4)15-24(23)34-28)33-21-7-5-20(6-8-21)11-12-32-16-29/h5-16H,1-4H3/b12-11+ |
| InChIKey | CHCXXEIWVPFQIL-VAWYXSNFSA-N |
| XLogP | 7.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|