C27H22O5S — CID 129221118
[(E)-2-[4-[[2-(2,4-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate (PubChem CID 129221118) has the molecular formula C27H22O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is [(E)-2-[4-[[2-(2,4-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate.
| Compound Name | [(E)-2-[4-[[2-(2,4-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate |
|---|---|
| PubChem CID | 129221118 |
| Molecular Formula | C27H22O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [(E)-2-[4-[[2-(2,4-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate |
| SMILES | COc1ccc2c(Oc3ccc(/C=C/OC=O)cc3)c(C(=O)c3ccc(C)cc3C)sc2c1 |
| InChI | InChI=1S/C27H22O5S/c1-17-4-10-22(18(2)14-17)25(29)27-26(23-11-9-21(30-3)15-24(23)33-27)32-20-7-5-19(6-8-20)12-13-31-16-28/h4-16H,1-3H3/b13-12+ |
| InChIKey | LQMQYDOFWHVWNT-OUKQBFOZSA-N |
| XLogP | 6.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|