C24H16O6S — CID 129221097
[(E)-2-[4-[[6-hydroxy-2-(2-hydroxybenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate (PubChem CID 129221097) has the molecular formula C24H16O6S and a molecular weight of 432.45 g/mol. Its IUPAC name is [(E)-2-[4-[[6-hydroxy-2-(2-hydroxybenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate.
| Compound Name | [(E)-2-[4-[[6-hydroxy-2-(2-hydroxybenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate |
|---|---|
| PubChem CID | 129221097 |
| Molecular Formula | C24H16O6S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [(E)-2-[4-[[6-hydroxy-2-(2-hydroxybenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]ethenyl] formate |
| SMILES | O=CO/C=C/c1ccc(Oc2c(C(=O)c3ccccc3O)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C24H16O6S/c25-14-29-12-11-15-5-8-17(9-6-15)30-23-19-10-7-16(26)13-21(19)31-24(23)22(28)18-3-1-2-4-20(18)27/h1-14,26-27H/b12-11+ |
| InChIKey | AHDCWTXSOZFKRF-VAWYXSNFSA-N |
| XLogP | 5.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|