C28H20O4S — CID 129228140
6-[[6-methoxy-2-(2-methylbenzoyl)-1-benzothiophen-3-yl]oxy]naphthalene-2-carbaldehyde (PubChem CID 129228140) has the molecular formula C28H20O4S and a molecular weight of 452.53 g/mol. Its IUPAC name is 6-[[6-methoxy-2-(2-methylbenzoyl)-1-benzothiophen-3-yl]oxy]naphthalene-2-carbaldehyde.
| Compound Name | 6-[[6-methoxy-2-(2-methylbenzoyl)-1-benzothiophen-3-yl]oxy]naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 129228140 |
| Molecular Formula | C28H20O4S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 6-[[6-methoxy-2-(2-methylbenzoyl)-1-benzothiophen-3-yl]oxy]naphthalene-2-carbaldehyde |
| SMILES | COc1ccc2c(Oc3ccc4cc(C=O)ccc4c3)c(C(=O)c3ccccc3C)sc2c1 |
| InChI | InChI=1S/C28H20O4S/c1-17-5-3-4-6-23(17)26(30)28-27(24-12-11-21(31-2)15-25(24)33-28)32-22-10-9-19-13-18(16-29)7-8-20(19)14-22/h3-16H,1-2H3 |
| InChIKey | RXRCYNDVAICALV-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|