C28H23FO4S — CID 167440137
methyl (E)-3-[4-[[6-fluoro-2-(2-propan-2-ylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate (PubChem CID 167440137) has the molecular formula C28H23FO4S and a molecular weight of 474.55 g/mol. Its IUPAC name is methyl (E)-3-[4-[[6-fluoro-2-(2-propan-2-ylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[6-fluoro-2-(2-propan-2-ylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 167440137 |
| Molecular Formula | C28H23FO4S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | methyl (E)-3-[4-[[6-fluoro-2-(2-propan-2-ylbenzoyl)-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(Oc2c(C(=O)c3ccccc3C(C)C)sc3cc(F)ccc23)cc1 |
| InChI | InChI=1S/C28H23FO4S/c1-17(2)21-6-4-5-7-22(21)26(31)28-27(23-14-11-19(29)16-24(23)34-28)33-20-12-8-18(9-13-20)10-15-25(30)32-3/h4-17H,1-3H3/b15-10+ |
| InChIKey | VXWAZAYEZQISQZ-XNTDXEJSSA-N |
| XLogP | 7.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|