C26H19FO4S — CID 167440132
(E)-3-[4-[[2-(3,5-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (PubChem CID 167440132) has the molecular formula C26H19FO4S and a molecular weight of 446.50 g/mol. Its IUPAC name is (E)-3-[4-[[2-(3,5-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-(3,5-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167440132 |
| Molecular Formula | C26H19FO4S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (E)-3-[4-[[2-(3,5-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C)cc(C(=O)c2sc3cc(F)ccc3c2Oc2ccc(/C=C/C(=O)O)cc2)c1 |
| InChI | InChI=1S/C26H19FO4S/c1-15-11-16(2)13-18(12-15)24(30)26-25(21-9-6-19(27)14-22(21)32-26)31-20-7-3-17(4-8-20)5-10-23(28)29/h3-14H,1-2H3,(H,28,29)/b10-5+ |
| InChIKey | QXHMJBBDZHNJDK-BJMVGYQFSA-N |
| XLogP | 6.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|