C27H22O4S — CID 129228137
(E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal (PubChem CID 129228137) has the molecular formula C27H22O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal.
| Compound Name | (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 129228137 |
| Molecular Formula | C27H22O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (E)-3-[4-[[2-(2,6-dimethylbenzoyl)-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal |
| SMILES | COc1ccc2c(Oc3ccc(/C=C/C=O)cc3)c(C(=O)c3c(C)cccc3C)sc2c1 |
| InChI | InChI=1S/C27H22O4S/c1-17-6-4-7-18(2)24(17)25(29)27-26(22-14-13-21(30-3)16-23(22)32-27)31-20-11-9-19(10-12-20)8-5-15-28/h4-16H,1-3H3/b8-5+ |
| InChIKey | TWMYPXHOMZWORM-VMPITWQZSA-N |
| XLogP | 6.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|