C26H19F3O3S — CID 129228239
(E)-3-[4-[[2-[difluoro-(4-fluoro-2-methylphenyl)methyl]-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal (PubChem CID 129228239) has the molecular formula C26H19F3O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is (E)-3-[4-[[2-[difluoro-(4-fluoro-2-methylphenyl)methyl]-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal.
| Compound Name | (E)-3-[4-[[2-[difluoro-(4-fluoro-2-methylphenyl)methyl]-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 129228239 |
| Molecular Formula | C26H19F3O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (E)-3-[4-[[2-[difluoro-(4-fluoro-2-methylphenyl)methyl]-6-methoxy-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enal |
| SMILES | COc1ccc2c(Oc3ccc(/C=C/C=O)cc3)c(C(F)(F)c3ccc(F)cc3C)sc2c1 |
| InChI | InChI=1S/C26H19F3O3S/c1-16-14-18(27)7-12-22(16)26(28,29)25-24(21-11-10-20(31-2)15-23(21)33-25)32-19-8-5-17(6-9-19)4-3-13-30/h3-15H,1-2H3/b4-3+ |
| InChIKey | ZBUGUTQMRDJSKH-ONEGZZNKSA-N |
| XLogP | 7.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|