About [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone
[3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 139404105) has the molecular formula C24H16N2O2S2
and a molecular weight of 428.54 g/mol. Its IUPAC name is [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone |
| PubChem CID | 139404105 |
| Molecular Formula | C24H16N2O2S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | Nc1ncc(-c2ccc(-c3c(C(=O)c4ccccc4)sc4cc(O)ccc34)cc2)s1 |
| InChI | InChI=1S/C24H16N2O2S2/c25-24-26-13-20(30-24)14-6-8-15(9-7-14)21-18-11-10-17(27)12-19(18)29-23(21)22(28)16-4-2-1-3-5-16/h1-13,27H,(H2,25,26) |
| InChIKey | GHIRPDQMQQRGMA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone?
The IUPAC name of [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone (CID 139404105) is [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone.
What is the SMILES notation for [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone?
The canonical SMILES for [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone is Nc1ncc(-c2ccc(-c3c(C(=O)c4ccccc4)sc4cc(O)ccc34)cc2)s1.
What is the InChIKey of [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone?
The InChIKey is GHIRPDQMQQRGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N2O2S2/c25-24-26-13-20(30-24)14-6-8-15(9-7-14)21-18-11-10-17(27)12-19(18)29-23(21)22(28)16-4-2-1-3-5-16/h1-13,27H,(H2,25,26).
What are the key properties of [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone?
[3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone has a molecular weight of 428.54 g/mol, XLogP of 6.21, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-6-hydroxy-1-benzothiophen-2-yl]-phenylmethanone is sourced from PubChem (CID 139404105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).