About 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one
3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 139403964) has the molecular formula C23H14N2O4S
and a molecular weight of 414.44 g/mol. Its IUPAC name is 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 139403964 |
| Molecular Formula | C23H14N2O4S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=C(c1ccccc1)c1sc2cc(O)ccc2c1-c1ccc(-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H14N2O4S/c26-16-10-11-17-18(12-16)30-21(20(27)14-4-2-1-3-5-14)19(17)13-6-8-15(9-7-13)22-24-23(28)29-25-22/h1-12,26H,(H,24,25,28) |
| InChIKey | BQHYIIXFLBKAHE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one (CID 139403964) is 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one is O=C(c1ccccc1)c1sc2cc(O)ccc2c1-c1ccc(-c2noc(=O)[nH]2)cc1.
What is the InChIKey of 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one?
The InChIKey is BQHYIIXFLBKAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14N2O4S/c26-16-10-11-17-18(12-16)30-21(20(27)14-4-2-1-3-5-14)19(17)13-6-8-15(9-7-13)22-24-23(28)29-25-22/h1-12,26H,(H,24,25,28).
What are the key properties of 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one?
3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one has a molecular weight of 414.44 g/mol, XLogP of 4.85, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 139403964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).