C26H16O4S2 — CID 139404172
5-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]thiophene-2-carboxylic acid (PubChem CID 139404172) has the molecular formula C26H16O4S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 139404172 |
| Molecular Formula | C26H16O4S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 5-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(-c3c(C(=O)c4ccccc4)sc4cc(O)ccc34)cc2)s1 |
| InChI | InChI=1S/C26H16O4S2/c27-18-10-11-19-22(14-18)32-25(24(28)17-4-2-1-3-5-17)23(19)16-8-6-15(7-9-16)20-12-13-21(31-20)26(29)30/h1-14,27H,(H,29,30) |
| InChIKey | WKJLZWWYKZGSKX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |