C24H21NO3S — CID 140896393
[6-hydroxy-3-[4-[2-(methylamino)ethoxy]phenyl]-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 140896393) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is [6-hydroxy-3-[4-[2-(methylamino)ethoxy]phenyl]-1-benzothiophen-2-yl]-phenylmethanone.
| Compound Name | [6-hydroxy-3-[4-[2-(methylamino)ethoxy]phenyl]-1-benzothiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 140896393 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [6-hydroxy-3-[4-[2-(methylamino)ethoxy]phenyl]-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | CNCCOc1ccc(-c2c(C(=O)c3ccccc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-25-13-14-28-19-10-7-16(8-11-19)22-20-12-9-18(26)15-21(20)29-24(22)23(27)17-5-3-2-4-6-17/h2-12,15,25-26H,13-14H2,1H3 |
| InChIKey | PAOJEHIFVLHVLQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|