C25H16O4S — CID 139404109
[6-hydroxy-3-[4-(3-hydroxyfuran-2-yl)phenyl]-1-benzothiophen-2-yl]-phenylmethanone (PubChem CID 139404109) has the molecular formula C25H16O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is [6-hydroxy-3-[4-(3-hydroxyfuran-2-yl)phenyl]-1-benzothiophen-2-yl]-phenylmethanone.
| Compound Name | [6-hydroxy-3-[4-(3-hydroxyfuran-2-yl)phenyl]-1-benzothiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139404109 |
| Molecular Formula | C25H16O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [6-hydroxy-3-[4-(3-hydroxyfuran-2-yl)phenyl]-1-benzothiophen-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1sc2cc(O)ccc2c1-c1ccc(-c2occc2O)cc1 |
| InChI | InChI=1S/C25H16O4S/c26-18-10-11-19-21(14-18)30-25(23(28)16-4-2-1-3-5-16)22(19)15-6-8-17(9-7-15)24-20(27)12-13-29-24/h1-14,26-27H |
| InChIKey | MWTKGCHRZUGVFA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |