C25H17ClO5S — CID 139403980
(E)-3-[4-[2-(4-chloro-2-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenoxy]prop-2-enoic acid (PubChem CID 139403980) has the molecular formula C25H17ClO5S and a molecular weight of 464.93 g/mol. Its IUPAC name is (E)-3-[4-[2-(4-chloro-2-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenoxy]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(4-chloro-2-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 139403980 |
| Molecular Formula | C25H17ClO5S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | (E)-3-[4-[2-(4-chloro-2-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenoxy]prop-2-enoic acid |
| SMILES | Cc1cc(Cl)ccc1C(=O)c1sc2cc(O)ccc2c1-c1ccc(O/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C25H17ClO5S/c1-14-12-16(26)4-8-19(14)24(30)25-23(20-9-5-17(27)13-21(20)32-25)15-2-6-18(7-3-15)31-11-10-22(28)29/h2-13,27H,1H3,(H,28,29)/b11-10+ |
| InChIKey | BGVUEFSJUGWNDB-ZHACJKMWSA-N |
| XLogP | 6.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|