C16H11ClO2S — CID 139391922
(3-chloro-6-hydroxy-1-benzothiophen-2-yl)-(2-methylphenyl)methanone (PubChem CID 139391922) has the molecular formula C16H11ClO2S and a molecular weight of 302.78 g/mol. Its IUPAC name is (3-chloro-6-hydroxy-1-benzothiophen-2-yl)-(2-methylphenyl)methanone.
| Compound Name | (3-chloro-6-hydroxy-1-benzothiophen-2-yl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 139391922 |
| Molecular Formula | C16H11ClO2S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (3-chloro-6-hydroxy-1-benzothiophen-2-yl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1sc2cc(O)ccc2c1Cl |
| InChI | InChI=1S/C16H11ClO2S/c1-9-4-2-3-5-11(9)15(19)16-14(17)12-7-6-10(18)8-13(12)20-16/h2-8,18H,1H3 |
| InChIKey | AKJVLOPPEILOGT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |