C18H15ClO3S — CID 3284691
(2,6-dimethylphenyl) 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 3284691) has the molecular formula C18H15ClO3S and a molecular weight of 346.84 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3284691 |
| Molecular Formula | C18H15ClO3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (2,6-dimethylphenyl) 3-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc2c(Cl)c(C(=O)Oc3c(C)cccc3C)sc2c1 |
| InChI | InChI=1S/C18H15ClO3S/c1-10-5-4-6-11(2)16(10)22-18(20)17-15(19)13-8-7-12(21-3)9-14(13)23-17/h4-9H,1-3H3 |
| InChIKey | BRYWOLDCPLULNH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|