C17H13ClO2S — CID 918099
(2,6-dimethylphenyl) 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 918099) has the molecular formula C17H13ClO2S and a molecular weight of 316.81 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 918099 |
| Molecular Formula | C17H13ClO2S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (2,6-dimethylphenyl) 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H13ClO2S/c1-10-6-5-7-11(2)15(10)20-17(19)16-14(18)12-8-3-4-9-13(12)21-16/h3-9H,1-2H3 |
| InChIKey | AZVBIVWXVFATOH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|