C24H17FO3S — CID 159332548
[3-(4-ethenoxyphenyl)-6-hydroxy-1-benzothiophen-2-yl]-(3-fluoro-5-methylphenyl)methanone (PubChem CID 159332548) has the molecular formula C24H17FO3S and a molecular weight of 404.46 g/mol. Its IUPAC name is [3-(4-ethenoxyphenyl)-6-hydroxy-1-benzothiophen-2-yl]-(3-fluoro-5-methylphenyl)methanone.
| Compound Name | [3-(4-ethenoxyphenyl)-6-hydroxy-1-benzothiophen-2-yl]-(3-fluoro-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 159332548 |
| Molecular Formula | C24H17FO3S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [3-(4-ethenoxyphenyl)-6-hydroxy-1-benzothiophen-2-yl]-(3-fluoro-5-methylphenyl)methanone |
| SMILES | C=COc1ccc(-c2c(C(=O)c3cc(C)cc(F)c3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C24H17FO3S/c1-3-28-19-7-4-15(5-8-19)22-20-9-6-18(26)13-21(20)29-24(22)23(27)16-10-14(2)11-17(25)12-16/h3-13,26H,1H2,2H3 |
| InChIKey | OFMMVYSWMGMKJU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|