C26H16FNO5S — CID 160899607
[2-[4-[2-(3-fluoro-5-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]-1,3-oxazol-4-yl] formate (PubChem CID 160899607) has the molecular formula C26H16FNO5S and a molecular weight of 473.48 g/mol. Its IUPAC name is [2-[4-[2-(3-fluoro-5-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]-1,3-oxazol-4-yl] formate.
| Compound Name | [2-[4-[2-(3-fluoro-5-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]-1,3-oxazol-4-yl] formate |
|---|---|
| PubChem CID | 160899607 |
| Molecular Formula | C26H16FNO5S |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [2-[4-[2-(3-fluoro-5-methylbenzoyl)-6-hydroxy-1-benzothiophen-3-yl]phenyl]-1,3-oxazol-4-yl] formate |
| SMILES | Cc1cc(F)cc(C(=O)c2sc3cc(O)ccc3c2-c2ccc(-c3nc(OC=O)co3)cc2)c1 |
| InChI | InChI=1S/C26H16FNO5S/c1-14-8-17(10-18(27)9-14)24(31)25-23(20-7-6-19(30)11-21(20)34-25)15-2-4-16(5-3-15)26-28-22(12-32-26)33-13-29/h2-13,30H,1H3 |
| InChIKey | XTQNPMMEPVAAMN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|