C17H11ClFNO4 — CID 134824207
N-[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]acetamide (PubChem CID 134824207) has the molecular formula C17H11ClFNO4 and a molecular weight of 347.73 g/mol. Its IUPAC name is N-[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]acetamide.
| Compound Name | N-[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 134824207 |
| Molecular Formula | C17H11ClFNO4 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[3-(3-chloro-4-fluorophenyl)-7-hydroxy-2-oxochromen-4-yl]acetamide |
| SMILES | CC(=O)Nc1c(-c2ccc(F)c(Cl)c2)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C17H11ClFNO4/c1-8(21)20-16-11-4-3-10(22)7-14(11)24-17(23)15(16)9-2-5-13(19)12(18)6-9/h2-7,22H,1H3,(H,20,21) |
| InChIKey | VBZWCVDRHNTMSW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|