C21H24O4 — CID 10617123
(E)-3-[4-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]phenyl]prop-2-enoic acid (PubChem CID 10617123) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (E)-3-[4-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10617123 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (E)-3-[4-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]phenyl]prop-2-enoic acid |
| SMILES | COc1c(C)c(C)c(OC)c(Cc2ccc(/C=C/C(=O)O)cc2)c1C |
| InChI | InChI=1S/C21H24O4/c1-13-14(2)21(25-5)18(15(3)20(13)24-4)12-17-8-6-16(7-9-17)10-11-19(22)23/h6-11H,12H2,1-5H3,(H,22,23)/b11-10+ |
| InChIKey | FOZAMQBOGCOCFE-ZHACJKMWSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|