C30H27NO3 — CID 139577662
4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]benzaldehyde (PubChem CID 139577662) has the molecular formula C30H27NO3 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]benzaldehyde.
| Compound Name | 4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 139577662 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-[7-(dimethylamino)-4-ethyl-2-oxochromen-3-yl]ethenyl]phenyl]ethenyl]benzaldehyde |
| SMILES | CCc1c(/C=C/c2ccc(/C=C/c3ccc(C=O)cc3)cc2)c(=O)oc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C30H27NO3/c1-4-26-27-18-16-25(31(2)3)19-29(27)34-30(33)28(26)17-15-23-9-7-21(8-10-23)5-6-22-11-13-24(20-32)14-12-22/h5-20H,4H2,1-3H3/b6-5+,17-15+ |
| InChIKey | RVFZSDPDSOXZIR-OJBURCBUSA-N |
| XLogP | 6.57 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|