C34H29N5O3 — CID 23385437
3-[(E)-2-[(4E)-4-[cyano(isocyano)methylidene]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-2-yl]ethenyl]-7-(diethylamino)-2-oxochromene-4-carbonitrile (PubChem CID 23385437) has the molecular formula C34H29N5O3 and a molecular weight of 555.64 g/mol. Its IUPAC name is 3-[(E)-2-[(4E)-4-[cyano(isocyano)methylidene]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-2-yl]ethenyl]-7-(diethylamino)-2-oxochromene-4-carbonitrile.
| Compound Name | 3-[(E)-2-[(4E)-4-[cyano(isocyano)methylidene]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-2-yl]ethenyl]-7-(diethylamino)-2-oxochromene-4-carbonitrile |
|---|---|
| PubChem CID | 23385437 |
| Molecular Formula | C34H29N5O3 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 3-[(E)-2-[(4E)-4-[cyano(isocyano)methylidene]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-2-yl]ethenyl]-7-(diethylamino)-2-oxochromene-4-carbonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2ccc(N(C)C)cc2)OC(/C=C/c2c(C#N)c3ccc(N(CC)CC)cc3oc2=O)=C1 |
| InChI | InChI=1S/C34H29N5O3/c1-6-39(7-2)26-13-16-29-31(21-35)30(34(40)42-33(29)20-26)17-15-28-19-24(32(22-36)37-3)18-27(41-28)14-10-23-8-11-25(12-9-23)38(4)5/h8-20H,6-7H2,1-2,4-5H3/b14-10+,17-15+,32-24+ |
| InChIKey | ZQLIOEXRJJKCFP-OVWBBPQBSA-N |
| XLogP | 6.80 |
| TPSA | 97.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|