C40H32N4O — CID 59700489
(2E)-2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 59700489) has the molecular formula C40H32N4O and a molecular weight of 584.72 g/mol. Its IUPAC name is (2E)-2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59700489 |
| Molecular Formula | C40H32N4O |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | (2E)-2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2ccc(N(CC)CC)cc2)OC(/C=C/c2ccc(-n3c4ccccc4c4ccccc43)cc2)=C1 |
| InChI | InChI=1S/C40H32N4O/c1-4-43(5-2)32-20-14-29(15-21-32)18-24-34-26-31(38(28-41)42-3)27-35(45-34)25-19-30-16-22-33(23-17-30)44-39-12-8-6-10-36(39)37-11-7-9-13-40(37)44/h6-27H,4-5H2,1-2H3/b24-18+,25-19+,38-31+ |
| InChIKey | QQDFTTFWVBNGQY-NXYFDMSHSA-N |
| XLogP | 9.85 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|