C37H33N3 — CID 132940991
4-[[4-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]phenyl]iminomethyl]-N,N-diethylaniline (PubChem CID 132940991) has the molecular formula C37H33N3 and a molecular weight of 519.69 g/mol. Its IUPAC name is 4-[[4-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]phenyl]iminomethyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]phenyl]iminomethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 132940991 |
| Molecular Formula | C37H33N3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 4-[[4-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]phenyl]iminomethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc(/C=C/c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H33N3/c1-3-39(4-2)32-23-19-30(20-24-32)27-38-31-21-15-28(16-22-31)13-14-29-17-25-33(26-18-29)40-36-11-7-5-9-34(36)35-10-6-8-12-37(35)40/h5-27H,3-4H2,1-2H3/b14-13+,38-27+ |
| InChIKey | AFQXUMLHWLXWOP-NTBUEYCISA-N |
| XLogP | 9.55 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|