C33H30N2O — CID 137082909
2-[[4-[(E)-2-anthracen-9-ylethenyl]phenyl]iminomethyl]-5-(diethylamino)phenol (PubChem CID 137082909) has the molecular formula C33H30N2O and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[[4-[(E)-2-anthracen-9-ylethenyl]phenyl]iminomethyl]-5-(diethylamino)phenol.
| Compound Name | 2-[[4-[(E)-2-anthracen-9-ylethenyl]phenyl]iminomethyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 137082909 |
| Molecular Formula | C33H30N2O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-[[4-[(E)-2-anthracen-9-ylethenyl]phenyl]iminomethyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc(/C=C/c3c4ccccc4cc4ccccc34)cc2)c(O)c1 |
| InChI | InChI=1S/C33H30N2O/c1-3-35(4-2)29-19-16-27(33(36)22-29)23-34-28-17-13-24(14-18-28)15-20-32-30-11-7-5-9-25(30)21-26-10-6-8-12-31(26)32/h5-23,36H,3-4H2,1-2H3/b20-15+,34-23+ |
| InChIKey | BPLHWLYWESZOOH-UBRLNVJXSA-N |
| XLogP | 8.47 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|