C38H28N4O — CID 87508126
2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 87508126) has the molecular formula C38H28N4O and a molecular weight of 556.67 g/mol. Its IUPAC name is 2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 87508126 |
| Molecular Formula | C38H28N4O |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 2-[2-[(E)-2-(4-carbazol-9-ylphenyl)ethenyl]-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(/C=C/C2=CC(=C(C#N)C#N)C=C(/C=C/c3ccc(-n4c5ccccc5c5ccccc54)cc3)O2)cc1 |
| InChI | InChI=1S/C38H28N4O/c1-41(2)31-17-11-27(12-18-31)15-21-33-23-29(30(25-39)26-40)24-34(43-33)22-16-28-13-19-32(20-14-28)42-37-9-5-3-7-35(37)36-8-4-6-10-38(36)42/h3-24H,1-2H3/b21-15+,22-16+ |
| InChIKey | QVKUFIMCUSIIEH-YHARCJFQSA-N |
| XLogP | 8.72 |
| TPSA | 64.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|