C52H42N4O3 — CID 88874024
2-[2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 88874024) has the molecular formula C52H42N4O3 and a molecular weight of 770.93 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88874024 |
| Molecular Formula | C52H42N4O3 |
| Molecular Weight | 770.93 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | 2-[2,6-bis[(E)-2-[4-(N-(4-methoxyphenyl)-4-methylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | COc1ccc(N(c2ccc(C)cc2)c2ccc(/C=C/C3=CC(=C(C#N)C#N)C=C(/C=C/c4ccc(N(c5ccc(C)cc5)c5ccc(OC)cc5)cc4)O3)cc2)cc1 |
| InChI | InChI=1S/C52H42N4O3/c1-37-5-15-43(16-6-37)55(47-23-29-49(57-3)30-24-47)45-19-9-39(10-20-45)13-27-51-33-41(42(35-53)36-54)34-52(59-51)28-14-40-11-21-46(22-12-40)56(44-17-7-38(2)8-18-44)48-25-31-50(58-4)32-26-48/h5-34H,1-4H3/b27-13+,28-14+ |
| InChIKey | LHSNCTSBTAMGQI-OCHFTUDZSA-N |
| XLogP | 13.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.93 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|