C29H21N3O — CID 91995005
2-[2-methyl-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 91995005) has the molecular formula C29H21N3O and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[2-methyl-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-methyl-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 91995005 |
| Molecular Formula | C29H21N3O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[2-methyl-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(C=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C29H21N3O/c1-22-18-24(25(20-30)21-31)19-29(33-22)17-14-23-12-15-28(16-13-23)32(26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-19H,1H3 |
| InChIKey | ODARNQWXSSLDLA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|