C46H36N6O — CID 11961079
2-[2,6-bis[(E)-2-[1-methyl-5-(N-phenylanilino)pyrrol-2-yl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 11961079) has the molecular formula C46H36N6O and a molecular weight of 688.84 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-[1-methyl-5-(N-phenylanilino)pyrrol-2-yl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2,6-bis[(E)-2-[1-methyl-5-(N-phenylanilino)pyrrol-2-yl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11961079 |
| Molecular Formula | C46H36N6O |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | 2-[2,6-bis[(E)-2-[1-methyl-5-(N-phenylanilino)pyrrol-2-yl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | Cn1c(/C=C/C2=CC(=C(C#N)C#N)C=C(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)n3C)O2)ccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H36N6O/c1-49-37(25-29-45(49)51(39-15-7-3-8-16-39)40-17-9-4-10-18-40)23-27-43-31-35(36(33-47)34-48)32-44(53-43)28-24-38-26-30-46(50(38)2)52(41-19-11-5-12-20-41)42-21-13-6-14-22-42/h3-32H,1-2H3/b27-23+,28-24+ |
| InChIKey | DWSVKBZAJYUSLZ-LMCGJEQXSA-N |
| XLogP | 11.17 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|