C20H12N2OS2 — CID 101087476
2-[2,6-bis[(E)-2-thiophen-2-ylethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 101087476) has the molecular formula C20H12N2OS2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-thiophen-2-ylethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2,6-bis[(E)-2-thiophen-2-ylethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 101087476 |
| Molecular Formula | C20H12N2OS2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[2,6-bis[(E)-2-thiophen-2-ylethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C(/C=C/c2cccs2)OC(/C=C/c2cccs2)=C1 |
| InChI | InChI=1S/C20H12N2OS2/c21-13-16(14-22)15-11-17(5-7-19-3-1-9-24-19)23-18(12-15)6-8-20-4-2-10-25-20/h1-12H/b7-5+,8-6+ |
| InChIKey | XLMJYERBVSWIPZ-KQQUZDAGSA-N |
| XLogP | 5.68 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|