C32H21N3O4 — CID 171441412
2-[2-tert-butyl-6-[(E)-2-(8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 171441412) has the molecular formula C32H21N3O4 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[(E)-2-(8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-tert-butyl-6-[(E)-2-(8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 171441412 |
| Molecular Formula | C32H21N3O4 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2-[2-tert-butyl-6-[(E)-2-(8,14,22-trioxa-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | CC(C)(C)C1=CC(=C(C#N)C#N)C=C(/C=C/c2cc3c4c(c2)Oc2cccc5c2N4c2c(cccc2O3)O5)O1 |
| InChI | InChI=1S/C32H21N3O4/c1-32(2,3)28-15-19(20(16-33)17-34)14-21(36-28)11-10-18-12-26-31-27(13-18)39-25-9-5-7-23-30(25)35(31)29-22(37-23)6-4-8-24(29)38-26/h4-15H,1-3H3/b11-10+ |
| InChIKey | CLZKOAHMWPJVJQ-ZHACJKMWSA-N |
| XLogP | 8.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|