C40H33N3O — CID 76646204
2-[2-tert-butyl-6-[2-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 76646204) has the molecular formula C40H33N3O and a molecular weight of 571.72 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[2-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2-tert-butyl-6-[2-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 76646204 |
| Molecular Formula | C40H33N3O |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 2-[2-tert-butyl-6-[2-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C=Cc2ccc(C=Cc3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)OC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C40H33N3O/c1-40(2,3)39-28-33(38(29-41)42-4)27-37(44-39)26-23-31-18-15-30(16-19-31)17-20-32-21-24-36(25-22-32)43(34-11-7-5-8-12-34)35-13-9-6-10-14-35/h5-28H,1-3H3 |
| InChIKey | UJIPRFXPBSAXQG-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|