C29H29NO — CID 141207518
4-[2-(6-tert-butyl-4H-pyran-2-yl)ethenyl]-N,N-diphenylaniline (PubChem CID 141207518) has the molecular formula C29H29NO and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-[2-(6-tert-butyl-4H-pyran-2-yl)ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[2-(6-tert-butyl-4H-pyran-2-yl)ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 141207518 |
| Molecular Formula | C29H29NO |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-[2-(6-tert-butyl-4H-pyran-2-yl)ethenyl]-N,N-diphenylaniline |
| SMILES | CC(C)(C)C1=CCC=C(C=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C29H29NO/c1-29(2,3)28-16-10-15-27(31-28)22-19-23-17-20-26(21-18-23)30(24-11-6-4-7-12-24)25-13-8-5-9-14-25/h4-9,11-22H,10H2,1-3H3 |
| InChIKey | VPIQYPYWVVRPGG-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |