C38H27N5O2 — CID 76646203
2-[2-tert-butyl-4-[cyano(isocyano)methylidene]-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyrano[3,2-b]pyran-8-ylidene]-2-isocyanoacetonitrile (PubChem CID 76646203) has the molecular formula C38H27N5O2 and a molecular weight of 585.67 g/mol. Its IUPAC name is 2-[2-tert-butyl-4-[cyano(isocyano)methylidene]-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyrano[3,2-b]pyran-8-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2-tert-butyl-4-[cyano(isocyano)methylidene]-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyrano[3,2-b]pyran-8-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 76646203 |
| Molecular Formula | C38H27N5O2 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-[2-tert-butyl-4-[cyano(isocyano)methylidene]-6-[2-[4-(N-phenylanilino)phenyl]ethenyl]pyrano[3,2-b]pyran-8-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C(C)(C)C)OC2=C1OC(C=Cc1ccc(N(c3ccccc3)c3ccccc3)cc1)=CC2=C(C#N)[N+]#[C-] |
| InChI | InChI=1S/C38H27N5O2/c1-38(2,3)35-23-32(34(25-40)42-5)36-37(45-35)31(33(24-39)41-4)22-30(44-36)21-18-26-16-19-29(20-17-26)43(27-12-8-6-9-13-27)28-14-10-7-11-15-28/h6-23H,1-3H3 |
| InChIKey | VXZBBVUHKLHHTQ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|