C28H21N3O — CID 20611692
(2Z)-2-isocyano-2-[6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,3-dihydropyran-4-ylidene]acetonitrile (PubChem CID 20611692) has the molecular formula C28H21N3O and a molecular weight of 415.50 g/mol. Its IUPAC name is (2Z)-2-isocyano-2-[6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,3-dihydropyran-4-ylidene]acetonitrile.
| Compound Name | (2Z)-2-isocyano-2-[6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,3-dihydropyran-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 20611692 |
| Molecular Formula | C28H21N3O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2Z)-2-isocyano-2-[6-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-2,3-dihydropyran-4-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)OCC1 |
| InChI | InChI=1S/C28H21N3O/c1-30-28(21-29)23-18-19-32-27(20-23)17-14-22-12-15-26(16-13-22)31(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-17,20H,18-19H2/b17-14+,28-23- |
| InChIKey | XSXKDMABFHTQQU-HPMLAZENSA-N |
| XLogP | 7.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|