C36H29N3O — CID 158452716
(2E)-2-isocyano-2-[7-[(E)-2-[4-(N-naphthalen-1-ylanilino)phenyl]ethenyl]-6-oxaspiro[4.5]dec-7-en-9-ylidene]acetonitrile (PubChem CID 158452716) has the molecular formula C36H29N3O and a molecular weight of 519.65 g/mol. Its IUPAC name is (2E)-2-isocyano-2-[7-[(E)-2-[4-(N-naphthalen-1-ylanilino)phenyl]ethenyl]-6-oxaspiro[4.5]dec-7-en-9-ylidene]acetonitrile.
| Compound Name | (2E)-2-isocyano-2-[7-[(E)-2-[4-(N-naphthalen-1-ylanilino)phenyl]ethenyl]-6-oxaspiro[4.5]dec-7-en-9-ylidene]acetonitrile |
|---|---|
| PubChem CID | 158452716 |
| Molecular Formula | C36H29N3O |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | (2E)-2-isocyano-2-[7-[(E)-2-[4-(N-naphthalen-1-ylanilino)phenyl]ethenyl]-6-oxaspiro[4.5]dec-7-en-9-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(/C=C/c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2)OC2(CCCC2)C1 |
| InChI | InChI=1S/C36H29N3O/c1-38-34(26-37)29-24-32(40-36(25-29)22-7-8-23-36)21-18-27-16-19-31(20-17-27)39(30-12-3-2-4-13-30)35-15-9-11-28-10-5-6-14-33(28)35/h2-6,9-21,24H,7-8,22-23,25H2/b21-18+,34-29- |
| InChIKey | LHYSSHCREXKDJU-BEHNAZTRSA-N |
| XLogP | 9.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|