C33H27N3O — CID 140728740
(2E)-2-isocyano-2-[8-methyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]acetonitrile (PubChem CID 140728740) has the molecular formula C33H27N3O and a molecular weight of 481.60 g/mol. Its IUPAC name is (2E)-2-isocyano-2-[8-methyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]acetonitrile.
| Compound Name | (2E)-2-isocyano-2-[8-methyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 140728740 |
| Molecular Formula | C33H27N3O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (2E)-2-isocyano-2-[8-methyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C=C(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)OC2=C1CCCC2C |
| InChI | InChI=1S/C33H27N3O/c1-24-10-9-15-30-31(32(23-34)35-2)22-29(37-33(24)30)21-18-25-16-19-28(20-17-25)36(26-11-5-3-6-12-26)27-13-7-4-8-14-27/h3-8,11-14,16-22,24H,9-10,15H2,1H3/b21-18+,32-31+ |
| InChIKey | AFSSATDGHBNJAE-MNFAYZTISA-N |
| XLogP | 8.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|