C48H32Br2N4O — CID 102468803
2-[2,6-bis[(E)-2-[4-(N-(4-bromophenyl)anilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 102468803) has the molecular formula C48H32Br2N4O and a molecular weight of 840.62 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-[4-(N-(4-bromophenyl)anilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2,6-bis[(E)-2-[4-(N-(4-bromophenyl)anilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102468803 |
| Molecular Formula | C48H32Br2N4O |
| Molecular Weight | 840.62 g/mol |
| Exact Mass | 838.09 |
| IUPAC Name | 2-[2,6-bis[(E)-2-[4-(N-(4-bromophenyl)anilino)phenyl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C(/C=C/c2ccc(N(c3ccccc3)c3ccc(Br)cc3)cc2)OC(/C=C/c2ccc(N(c3ccccc3)c3ccc(Br)cc3)cc2)=C1 |
| InChI | InChI=1S/C48H32Br2N4O/c49-39-17-25-45(26-18-39)53(41-7-3-1-4-8-41)43-21-11-35(12-22-43)15-29-47-31-37(38(33-51)34-52)32-48(55-47)30-16-36-13-23-44(24-14-36)54(42-9-5-2-6-10-42)46-27-19-40(50)20-28-46/h1-32H/b29-15+,30-16+ |
| InChIKey | KCWDWIDSTRFHHP-CMNXJCJSSA-N |
| XLogP | 14.02 |
| TPSA | 63.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.62 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|