C44H33N5O — CID 58933282
2-[2-[(E)-2-[4-[[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]diazenyl]phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile (PubChem CID 58933282) has the molecular formula C44H33N5O and a molecular weight of 647.78 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-[[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]diazenyl]phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-[4-[[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]diazenyl]phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 58933282 |
| Molecular Formula | C44H33N5O |
| Molecular Weight | 647.78 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | 2-[2-[(E)-2-[4-[[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenyl]diazenyl]phenyl]ethenyl]-6-methylpyran-4-ylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(/C=C/c2ccc(/N=N/c3ccc(N(c4ccccc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)cc2)O1 |
| InChI | InChI=1S/C44H33N5O/c1-30-25-32(33(28-45)29-46)26-39(50-30)23-15-31-13-16-34(17-14-31)47-48-35-18-20-37(21-19-35)49(36-9-5-4-6-10-36)38-22-24-41-40-11-7-8-12-42(40)44(2,3)43(41)27-38/h4-27H,1-3H3/b23-15+,48-47+ |
| InChIKey | HFMZYKJNOJQMSK-ABBIZQHQSA-N |
| XLogP | 12.05 |
| TPSA | 84.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.78 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|