C41H29N3OS — CID 138500558
2-[2-[(E)-2-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile (PubChem CID 138500558) has the molecular formula C41H29N3OS and a molecular weight of 611.77 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500558 |
| Molecular Formula | C41H29N3OS |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 2-[2-[(E)-2-[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]thiophen-2-yl]ethenyl]-6-phenylpyran-4-ylidene]propanedinitrile |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2sc(/C=C/C3=CC(=C(C#N)C#N)C=C(c4ccccc4)O3)cc21 |
| InChI | InChI=1S/C41H29N3OS/c1-41(2)37-24-33(44(31-14-8-4-9-15-31)32-16-10-5-11-17-32)18-21-36(37)40-38(41)25-35(46-40)20-19-34-22-29(30(26-42)27-43)23-39(45-34)28-12-6-3-7-13-28/h3-25H,1-2H3/b20-19+ |
| InChIKey | YKBDXTWXXJIATE-FMQUCBEESA-N |
| XLogP | 10.84 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|