C56H38N4O — CID 11961177
2-[2,6-bis[(E)-2-[4-(N-phenylanilino)naphthalen-1-yl]ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 11961177) has the molecular formula C56H38N4O and a molecular weight of 782.95 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-[4-(N-phenylanilino)naphthalen-1-yl]ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2,6-bis[(E)-2-[4-(N-phenylanilino)naphthalen-1-yl]ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11961177 |
| Molecular Formula | C56H38N4O |
| Molecular Weight | 782.95 g/mol |
| Exact Mass | 782.30 |
| IUPAC Name | 2-[2,6-bis[(E)-2-[4-(N-phenylanilino)naphthalen-1-yl]ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)c3ccccc23)OC(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)c3ccccc23)=C1 |
| InChI | InChI=1S/C56H38N4O/c57-39-44(40-58)43-37-49(33-29-41-31-35-55(53-27-15-13-25-51(41)53)59(45-17-5-1-6-18-45)46-19-7-2-8-20-46)61-50(38-43)34-30-42-32-36-56(54-28-16-14-26-52(42)54)60(47-21-9-3-10-22-47)48-23-11-4-12-24-48/h1-38H/b33-29+,34-30+ |
| InChIKey | DKDLCHUIBMJRFO-BNRZXNFUSA-N |
| XLogP | 14.80 |
| TPSA | 63.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.95 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|