C24H14N2Na2O7S2 — CID 44602789
disodium;2-[(E)-2-[4-(dicyanomethylidene)-6-[(E)-2-(2-sulfonatophenyl)ethenyl]pyran-2-yl]ethenyl]benzenesulfonate (PubChem CID 44602789) has the molecular formula C24H14N2Na2O7S2 and a molecular weight of 552.50 g/mol. Its IUPAC name is disodium;2-[(E)-2-[4-(dicyanomethylidene)-6-[(E)-2-(2-sulfonatophenyl)ethenyl]pyran-2-yl]ethenyl]benzenesulfonate.
| Compound Name | disodium;2-[(E)-2-[4-(dicyanomethylidene)-6-[(E)-2-(2-sulfonatophenyl)ethenyl]pyran-2-yl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 44602789 |
| Molecular Formula | C24H14N2Na2O7S2 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | disodium;2-[(E)-2-[4-(dicyanomethylidene)-6-[(E)-2-(2-sulfonatophenyl)ethenyl]pyran-2-yl]ethenyl]benzenesulfonate |
| SMILES | N#CC(C#N)=C1C=C(/C=C/c2ccccc2S(=O)(=O)[O-])OC(/C=C/c2ccccc2S(=O)(=O)[O-])=C1.[Na+].[Na+] |
| InChI | InChI=1S/C24H16N2O7S2.2Na/c25-15-20(16-26)19-13-21(11-9-17-5-1-3-7-23(17)34(27,28)29)33-22(14-19)12-10-18-6-2-4-8-24(18)35(30,31)32;;/h1-14H,(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2/b11-9+,12-10+;; |
| InChIKey | FGVSPTBPDJMEHQ-JDDKLYJPSA-L |
| XLogP | -2.63 |
| TPSA | 171.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|