C17H12N2O4S — CID 101488664
2-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]benzenesulfonic acid (PubChem CID 101488664) has the molecular formula C17H12N2O4S and a molecular weight of 340.36 g/mol. Its IUPAC name is 2-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 101488664 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-[(E)-2-[4-(dicyanomethylidene)-6-methylpyran-2-yl]ethenyl]benzenesulfonic acid |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(/C=C/c2ccccc2S(=O)(=O)O)O1 |
| InChI | InChI=1S/C17H12N2O4S/c1-12-8-14(15(10-18)11-19)9-16(23-12)7-6-13-4-2-3-5-17(13)24(20,21)22/h2-9H,1H3,(H,20,21,22)/b7-6+ |
| InChIKey | IRMQLAWTBAUTMP-VOTSOKGWSA-N |
| XLogP | 3.11 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|